C8H13FO — CID 125453619
(2S,3S,6R)-2-fluoro-3,6-dimethylcyclohexan-1-one (PubChem CID 125453619) has the molecular formula C8H13FO and a molecular weight of 144.19 g/mol. Its IUPAC name is (2S,3S,6R)-2-fluoro-3,6-dimethylcyclohexan-1-one.
| Compound Name | (2S,3S,6R)-2-fluoro-3,6-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 125453619 |
| Molecular Formula | C8H13FO |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (2S,3S,6R)-2-fluoro-3,6-dimethylcyclohexan-1-one |
| SMILES | C[C@@H]1CC[C@H](C)[C@H](F)C1=O |
| InChI | InChI=1S/C8H13FO/c1-5-3-4-6(2)8(10)7(5)9/h5-7H,3-4H2,1-2H3/t5-,6+,7-/m0/s1 |
| InChIKey | MIZUIBGPNDRZIO-XVMARJQXSA-N |
| XLogP | 1.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |