C11H16O2 — CID 71328693
2,5-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-indene-1,4-dione (PubChem CID 71328693) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2,5-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-indene-1,4-dione.
| Compound Name | 2,5-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-indene-1,4-dione |
|---|---|
| PubChem CID | 71328693 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2,5-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-indene-1,4-dione |
| SMILES | CC1CC2C(=O)C(C)CCC2C1=O |
| InChI | InChI=1S/C11H16O2/c1-6-3-4-8-9(10(6)12)5-7(2)11(8)13/h6-9H,3-5H2,1-2H3 |
| InChIKey | LPZJUDQRYQKZOU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |