About (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one
(2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one (PubChem CID 163684638) has the molecular formula C6H9FO
and a molecular weight of 116.13 g/mol. Its IUPAC name is (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one.
Analyze (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one?
The IUPAC name of (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one (CID 163684638) is (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one.
What is the SMILES notation for (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one?
The canonical SMILES for (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one is C[C@H]1[C@H](F)C(=O)[C@@H]1C.
What is the InChIKey of (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one?
The InChIKey is JNTSXWJDMICMTN-WDCZJNDASA-N. The full InChI is InChI=1S/C6H9FO/c1-3-4(2)6(8)5(3)7/h3-5H,1-2H3/t3-,4-,5+/m1/s1.
What are the key properties of (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one?
(2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one has a molecular weight of 116.13 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R,4R)-2-fluoro-3,4-dimethylcyclobutan-1-one is sourced from PubChem (CID 163684638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).