C11H5F5O2 — CID 51412322
(2R,3S)-2,5,6,7,8-pentafluoro-3-methyl-2,3-dihydronaphthalene-1,4-dione (PubChem CID 51412322) has the molecular formula C11H5F5O2 and a molecular weight of 264.15 g/mol. Its IUPAC name is (2R,3S)-2,5,6,7,8-pentafluoro-3-methyl-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | (2R,3S)-2,5,6,7,8-pentafluoro-3-methyl-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 51412322 |
| Molecular Formula | C11H5F5O2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | (2R,3S)-2,5,6,7,8-pentafluoro-3-methyl-2,3-dihydronaphthalene-1,4-dione |
| SMILES | C[C@H]1C(=O)c2c(F)c(F)c(F)c(F)c2C(=O)[C@@H]1F |
| InChI | InChI=1S/C11H5F5O2/c1-2-5(12)11(18)4-3(10(2)17)6(13)8(15)9(16)7(4)14/h2,5H,1H3/t2-,5-/m1/s1 |
| InChIKey | BXXPRZHLICKJRD-DUZGATOHSA-N |
| XLogP | 2.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|