C8H10F2N2O2S — CID 125454362
5-amino-2,3-difluoro-N,4-dimethylbenzenesulfonamide (PubChem CID 125454362) has the molecular formula C8H10F2N2O2S and a molecular weight of 236.24 g/mol. Its IUPAC name is 5-amino-2,3-difluoro-N,4-dimethylbenzenesulfonamide.
| Compound Name | 5-amino-2,3-difluoro-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 125454362 |
| Molecular Formula | C8H10F2N2O2S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 5-amino-2,3-difluoro-N,4-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)c(C)c(F)c1F |
| InChI | InChI=1S/C8H10F2N2O2S/c1-4-5(11)3-6(8(10)7(4)9)15(13,14)12-2/h3,12H,11H2,1-2H3 |
| InChIKey | ROQJBZJIDUIKHG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|