C16H22N4O2S — CID 150081930
5-(4,5-diamino-2,3-dimethylphenyl)sulfonyl-3,4-dimethylbenzene-1,2-diamine (PubChem CID 150081930) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 5-(4,5-diamino-2,3-dimethylphenyl)sulfonyl-3,4-dimethylbenzene-1,2-diamine.
| Compound Name | 5-(4,5-diamino-2,3-dimethylphenyl)sulfonyl-3,4-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 150081930 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 5-(4,5-diamino-2,3-dimethylphenyl)sulfonyl-3,4-dimethylbenzene-1,2-diamine |
| SMILES | Cc1c(S(=O)(=O)c2cc(N)c(N)c(C)c2C)cc(N)c(N)c1C |
| InChI | InChI=1S/C16H22N4O2S/c1-7-9(3)15(19)11(17)5-13(7)23(21,22)14-6-12(18)16(20)10(4)8(14)2/h5-6H,17-20H2,1-4H3 |
| InChIKey | DRLGSHMGXCIULF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|