C15H9BrF5NO — CID 125464714
2-bromo-N-[2,2-difluoro-2-(2,4,6-trifluorophenyl)ethyl]benzamide (PubChem CID 125464714) has the molecular formula C15H9BrF5NO and a molecular weight of 394.14 g/mol. Its IUPAC name is 2-bromo-N-[2,2-difluoro-2-(2,4,6-trifluorophenyl)ethyl]benzamide.
| Compound Name | 2-bromo-N-[2,2-difluoro-2-(2,4,6-trifluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 125464714 |
| Molecular Formula | C15H9BrF5NO |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 2-bromo-N-[2,2-difluoro-2-(2,4,6-trifluorophenyl)ethyl]benzamide |
| SMILES | O=C(NCC(F)(F)c1c(F)cc(F)cc1F)c1ccccc1Br |
| InChI | InChI=1S/C15H9BrF5NO/c16-10-4-2-1-3-9(10)14(23)22-7-15(20,21)13-11(18)5-8(17)6-12(13)19/h1-6H,7H2,(H,22,23) |
| InChIKey | IXLLLKPCWOLNHA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |