C34H68N2O — CID 125469875
4-(dimethylamino)-N-[(8R)-1-[(1S,2S)-2-octylcyclopropyl]heptadecan-8-yl]butanamide (PubChem CID 125469875) has the molecular formula C34H68N2O and a molecular weight of 520.93 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(8R)-1-[(1S,2S)-2-octylcyclopropyl]heptadecan-8-yl]butanamide.
| Compound Name | 4-(dimethylamino)-N-[(8R)-1-[(1S,2S)-2-octylcyclopropyl]heptadecan-8-yl]butanamide |
|---|---|
| PubChem CID | 125469875 |
| Molecular Formula | C34H68N2O |
| Molecular Weight | 520.93 g/mol |
| Exact Mass | 520.53 |
| IUPAC Name | 4-(dimethylamino)-N-[(8R)-1-[(1S,2S)-2-octylcyclopropyl]heptadecan-8-yl]butanamide |
| SMILES | CCCCCCCCC[C@H](CCCCCCC[C@H]1C[C@@H]1CCCCCCCC)NC(=O)CCCN(C)C |
| InChI | InChI=1S/C34H68N2O/c1-5-7-9-11-13-17-21-26-33(35-34(37)28-23-29-36(3)4)27-22-18-14-16-20-25-32-30-31(32)24-19-15-12-10-8-6-2/h31-33H,5-30H2,1-4H3,(H,35,37)/t31-,32-,33+/m0/s1 |
| InChIKey | UBEBIZQFEHRONO-XFCANUNOSA-N |
| XLogP | 10.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.93 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|