C18H19BO2 — CID 125469948
[(1S)-spiro[cyclohexane-2,9'-fluorene]-1-yl]boronic acid (PubChem CID 125469948) has the molecular formula C18H19BO2 and a molecular weight of 278.16 g/mol. Its IUPAC name is [(1S)-spiro[cyclohexane-2,9'-fluorene]-1-yl]boronic acid.
| Compound Name | [(1S)-spiro[cyclohexane-2,9'-fluorene]-1-yl]boronic acid |
|---|---|
| PubChem CID | 125469948 |
| Molecular Formula | C18H19BO2 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [(1S)-spiro[cyclohexane-2,9'-fluorene]-1-yl]boronic acid |
| SMILES | OB(O)[C@H]1CCCCC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C18H19BO2/c20-19(21)17-11-5-6-12-18(17)15-9-3-1-7-13(15)14-8-2-4-10-16(14)18/h1-4,7-10,17,20-21H,5-6,11-12H2/t17-/m0/s1 |
| InChIKey | YRBBIZBTHDTKMR-KRWDZBQOSA-N |
| XLogP | 3.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|