C18H20O2 — CID 125473550
[(1S,2R)-2-ethoxycyclopropyl]-diphenylmethanol (PubChem CID 125473550) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is [(1S,2R)-2-ethoxycyclopropyl]-diphenylmethanol.
| Compound Name | [(1S,2R)-2-ethoxycyclopropyl]-diphenylmethanol |
|---|---|
| PubChem CID | 125473550 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [(1S,2R)-2-ethoxycyclopropyl]-diphenylmethanol |
| SMILES | CCO[C@@H]1C[C@@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-2-20-17-13-16(17)18(19,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16-17,19H,2,13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | DUXVQOOVYWAZNW-DLBZAZTESA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |