C17H18O2S — CID 132553835
[(2S,4R)-4-methyl-1-oxothietan-2-yl]-diphenylmethanol (PubChem CID 132553835) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is [(2S,4R)-4-methyl-1-oxothietan-2-yl]-diphenylmethanol.
| Compound Name | [(2S,4R)-4-methyl-1-oxothietan-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 132553835 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [(2S,4R)-4-methyl-1-oxothietan-2-yl]-diphenylmethanol |
| SMILES | CC1C[C@@H](C(O)(c2ccccc2)c2ccccc2)S1=O |
| InChI | InChI=1S/C17H18O2S/c1-13-12-16(20(13)19)17(18,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13,16,18H,12H2,1H3/t13?,16-,20?/m0/s1 |
| InChIKey | LJRFOCFMZVMEBZ-FOCKTWCOSA-N |
| XLogP | 2.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |