C26H26N2O4 — CID 134501631
ethyl (3aR,8bR)-3-hydroxy-2-[hydroxy(diphenyl)methyl]-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-4-carboxylate (PubChem CID 134501631) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is ethyl (3aR,8bR)-3-hydroxy-2-[hydroxy(diphenyl)methyl]-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-4-carboxylate.
| Compound Name | ethyl (3aR,8bR)-3-hydroxy-2-[hydroxy(diphenyl)methyl]-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 134501631 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | ethyl (3aR,8bR)-3-hydroxy-2-[hydroxy(diphenyl)methyl]-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-4-carboxylate |
| SMILES | CCOC(=O)N1c2ccccc2[C@H]2CC(C(O)(c3ccccc3)c3ccccc3)N(O)[C@H]21 |
| InChI | InChI=1S/C26H26N2O4/c1-2-32-25(29)27-22-16-10-9-15-20(22)21-17-23(28(31)24(21)27)26(30,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,21,23-24,30-31H,2,17H2,1H3/t21-,23?,24-/m1/s1 |
| InChIKey | SIQLWTSIKIPDDC-VNDUYKDKSA-N |
| XLogP | 4.47 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |