methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate

C10H14O4 — CID 125474655

IUPACmethyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate
SMILESCOC(=O)C1=CC(C)=C(C)[C@@H](OC)O1
InChIInChI=1S/C10H14O4/c1-6-5-8(9(11)12-3)14-10(13-4)7(6)2/h5,10H,1-4H3/t10-/m0/s1
InChIKeyTZIUBVORBBVORI-JTQLQIEISA-N
MW198.22 g/mol
LogP1.38
Rot. Bonds2

About methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate

methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate (PubChem CID 125474655) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate.

Molecular Properties

Compound Namemethyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate
PubChem CID125474655
Molecular FormulaC10H14O4
Molecular Weight198.22 g/mol
Exact Mass198.09
IUPAC Namemethyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate
SMILESCOC(=O)C1=CC(C)=C(C)[C@@H](OC)O1
InChIInChI=1S/C10H14O4/c1-6-5-8(9(11)12-3)14-10(13-4)7(6)2/h5,10H,1-4H3/t10-/m0/s1
InChIKeyTZIUBVORBBVORI-JTQLQIEISA-N
XLogP1.38
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 51.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate?
The IUPAC name of methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate (CID 125474655) is methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate.
What is the SMILES notation for methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate?
The canonical SMILES for methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate is COC(=O)C1=CC(C)=C(C)[C@@H](OC)O1.
What is the InChIKey of methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate?
The InChIKey is TZIUBVORBBVORI-JTQLQIEISA-N. The full InChI is InChI=1S/C10H14O4/c1-6-5-8(9(11)12-3)14-10(13-4)7(6)2/h5,10H,1-4H3/t10-/m0/s1.
What are the key properties of methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate?
methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-methoxy-3,4-dimethyl-2H-pyran-6-carboxylate is sourced from PubChem (CID 125474655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).