C12H14O4 — CID 125476085
(3S,4S)-4-(hydroxymethyl)-3-(2-methoxyphenyl)oxolan-2-one (PubChem CID 125476085) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (3S,4S)-4-(hydroxymethyl)-3-(2-methoxyphenyl)oxolan-2-one.
| Compound Name | (3S,4S)-4-(hydroxymethyl)-3-(2-methoxyphenyl)oxolan-2-one |
|---|---|
| PubChem CID | 125476085 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (3S,4S)-4-(hydroxymethyl)-3-(2-methoxyphenyl)oxolan-2-one |
| SMILES | COc1ccccc1[C@H]1C(=O)OC[C@@H]1CO |
| InChI | InChI=1S/C12H14O4/c1-15-10-5-3-2-4-9(10)11-8(6-13)7-16-12(11)14/h2-5,8,11,13H,6-7H2,1H3/t8-,11-/m0/s1 |
| InChIKey | MDBBKXYBTJDTOH-KWQFWETISA-N |
| XLogP | 0.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |