C11H10F3NO3S — CID 125476706
N-[(E)-2-[4-(trifluoromethyl)phenyl]sulfonylethenyl]acetamide (PubChem CID 125476706) has the molecular formula C11H10F3NO3S and a molecular weight of 293.27 g/mol. Its IUPAC name is N-[(E)-2-[4-(trifluoromethyl)phenyl]sulfonylethenyl]acetamide.
| Compound Name | N-[(E)-2-[4-(trifluoromethyl)phenyl]sulfonylethenyl]acetamide |
|---|---|
| PubChem CID | 125476706 |
| Molecular Formula | C11H10F3NO3S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-[(E)-2-[4-(trifluoromethyl)phenyl]sulfonylethenyl]acetamide |
| SMILES | CC(=O)N/C=C/S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3NO3S/c1-8(16)15-6-7-19(17,18)10-4-2-9(3-5-10)11(12,13)14/h2-7H,1H3,(H,15,16)/b7-6+ |
| InChIKey | OLGQZBXRRNNTLN-VOTSOKGWSA-N |
| XLogP | 2.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |