C7H12N2S2 — CID 125477030
(9aS)-2,3,4,5,9,9a-hexahydro-1H-[1,3]thiazolo[3,4-a][1,3]diazepine-7-thione (PubChem CID 125477030) has the molecular formula C7H12N2S2 and a molecular weight of 188.32 g/mol. Its IUPAC name is (9aS)-2,3,4,5,9,9a-hexahydro-1H-[1,3]thiazolo[3,4-a][1,3]diazepine-7-thione.
| Compound Name | (9aS)-2,3,4,5,9,9a-hexahydro-1H-[1,3]thiazolo[3,4-a][1,3]diazepine-7-thione |
|---|---|
| PubChem CID | 125477030 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (9aS)-2,3,4,5,9,9a-hexahydro-1H-[1,3]thiazolo[3,4-a][1,3]diazepine-7-thione |
| SMILES | S=C1SC[C@H]2NCCCCN12 |
| InChI | InChI=1S/C7H12N2S2/c10-7-9-4-2-1-3-8-6(9)5-11-7/h6,8H,1-5H2/t6-/m0/s1 |
| InChIKey | JEXYIVYUSWJFRZ-LURJTMIESA-N |
| XLogP | 1.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|