C12H16 — CID 125478662
1-(3,4-dimethylpenta-1,2-dienyl)-1-ethynylcyclopropane (PubChem CID 125478662) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-(3,4-dimethylpenta-1,2-dienyl)-1-ethynylcyclopropane.
| Compound Name | 1-(3,4-dimethylpenta-1,2-dienyl)-1-ethynylcyclopropane |
|---|---|
| PubChem CID | 125478662 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-(3,4-dimethylpenta-1,2-dienyl)-1-ethynylcyclopropane |
| SMILES | C#CC1(C=C=C(C)C(C)C)CC1 |
| InChI | InChI=1S/C12H16/c1-5-12(8-9-12)7-6-11(4)10(2)3/h1,7,10H,8-9H2,2-4H3 |
| InChIKey | YZMITYSZAUBVFC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|