C13H17N3O6 — CID 125479618
[2-(carbamoyloxymethyl)-2-(4-nitrophenyl)butyl] carbamate (PubChem CID 125479618) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is [2-(carbamoyloxymethyl)-2-(4-nitrophenyl)butyl] carbamate.
| Compound Name | [2-(carbamoyloxymethyl)-2-(4-nitrophenyl)butyl] carbamate |
|---|---|
| PubChem CID | 125479618 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [2-(carbamoyloxymethyl)-2-(4-nitrophenyl)butyl] carbamate |
| SMILES | CCC(COC(N)=O)(COC(N)=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17N3O6/c1-2-13(7-21-11(14)17,8-22-12(15)18)9-3-5-10(6-4-9)16(19)20/h3-6H,2,7-8H2,1H3,(H2,14,17)(H2,15,18) |
| InChIKey | LMDABWWLJYSFCV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|