C19H20N2O2 — CID 125480900
(3aS,9bS)-2-benzyl-3a-nitro-3,4,5,9b-tetrahydro-1H-benzo[e]isoindole (PubChem CID 125480900) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (3aS,9bS)-2-benzyl-3a-nitro-3,4,5,9b-tetrahydro-1H-benzo[e]isoindole.
| Compound Name | (3aS,9bS)-2-benzyl-3a-nitro-3,4,5,9b-tetrahydro-1H-benzo[e]isoindole |
|---|---|
| PubChem CID | 125480900 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (3aS,9bS)-2-benzyl-3a-nitro-3,4,5,9b-tetrahydro-1H-benzo[e]isoindole |
| SMILES | O=[N+]([O-])[C@@]12CCc3ccccc3[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C19H20N2O2/c22-21(23)19-11-10-16-8-4-5-9-17(16)18(19)13-20(14-19)12-15-6-2-1-3-7-15/h1-9,18H,10-14H2/t18-,19-/m1/s1 |
| InChIKey | YZFQDGILOOBLOO-RTBURBONSA-N |
| XLogP | 3.25 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|