C10H11ClN4 — CID 125480920
1-(2-chloro-6-ethylphenyl)-1,2,4-triazol-3-amine (PubChem CID 125480920) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 1-(2-chloro-6-ethylphenyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(2-chloro-6-ethylphenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 125480920 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-(2-chloro-6-ethylphenyl)-1,2,4-triazol-3-amine |
| SMILES | CCc1cccc(Cl)c1-n1cnc(N)n1 |
| InChI | InChI=1S/C10H11ClN4/c1-2-7-4-3-5-8(11)9(7)15-6-13-10(12)14-15/h3-6H,2H2,1H3,(H2,12,14) |
| InChIKey | NEYNZVIJDKJYKT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |