C18H17NO — CID 125482287
2-(2,5-diphenylpyrrol-1-yl)ethanol (PubChem CID 125482287) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-(2,5-diphenylpyrrol-1-yl)ethanol.
| Compound Name | 2-(2,5-diphenylpyrrol-1-yl)ethanol |
|---|---|
| PubChem CID | 125482287 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(2,5-diphenylpyrrol-1-yl)ethanol |
| SMILES | OCCn1c(-c2ccccc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C18H17NO/c20-14-13-19-17(15-7-3-1-4-8-15)11-12-18(19)16-9-5-2-6-10-16/h1-12,20H,13-14H2 |
| InChIKey | OHSYIGMYOACWET-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |