C20H20N2O2 — CID 155384826
4-(2,5-diphenylpyrrol-1-yl)-N-hydroxybutanamide (PubChem CID 155384826) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-(2,5-diphenylpyrrol-1-yl)-N-hydroxybutanamide.
| Compound Name | 4-(2,5-diphenylpyrrol-1-yl)-N-hydroxybutanamide |
|---|---|
| PubChem CID | 155384826 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-(2,5-diphenylpyrrol-1-yl)-N-hydroxybutanamide |
| SMILES | O=C(CCCn1c(-c2ccccc2)ccc1-c1ccccc1)NO |
| InChI | InChI=1S/C20H20N2O2/c23-20(21-24)12-7-15-22-18(16-8-3-1-4-9-16)13-14-19(22)17-10-5-2-6-11-17/h1-6,8-11,13-14,24H,7,12,15H2,(H,21,23) |
| InChIKey | JTUDQUNHZVQEIX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|