C13H21ClO — CID 125482892
3-[(1R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propanoyl chloride (PubChem CID 125482892) has the molecular formula C13H21ClO and a molecular weight of 228.76 g/mol. Its IUPAC name is 3-[(1R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propanoyl chloride.
| Compound Name | 3-[(1R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propanoyl chloride |
|---|---|
| PubChem CID | 125482892 |
| Molecular Formula | C13H21ClO |
| Molecular Weight | 228.76 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-[(1R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propanoyl chloride |
| SMILES | O=C(Cl)CC[C@H]1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H21ClO/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h10-12H,1-9H2/t10-,11-,12-/m1/s1 |
| InChIKey | QUOHAOBPOZJELV-IJLUTSLNSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|