C14H17NO3 — CID 125486430
(Z,6S)-6-(1-cyanocyclopropyl)-6-hydroxy-3-propylhept-2-en-4-ynoic acid (PubChem CID 125486430) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (Z,6S)-6-(1-cyanocyclopropyl)-6-hydroxy-3-propylhept-2-en-4-ynoic acid.
| Compound Name | (Z,6S)-6-(1-cyanocyclopropyl)-6-hydroxy-3-propylhept-2-en-4-ynoic acid |
|---|---|
| PubChem CID | 125486430 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (Z,6S)-6-(1-cyanocyclopropyl)-6-hydroxy-3-propylhept-2-en-4-ynoic acid |
| SMILES | CCC/C(C#C[C@](C)(O)C1(C#N)CC1)=C/C(=O)O |
| InChI | InChI=1S/C14H17NO3/c1-3-4-11(9-12(16)17)5-6-13(2,18)14(10-15)7-8-14/h9,18H,3-4,7-8H2,1-2H3,(H,16,17)/b11-9-/t13-/m0/s1 |
| InChIKey | FPRNKLXUZJHXPP-FUWURINLSA-N |
| XLogP | 1.86 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|