C12H11F3N2O2 — CID 125486504
(Z,6S)-6-(1-cyanocyclopropyl)-6-hydroxy-3-(trifluoromethyl)hept-2-en-4-ynamide (PubChem CID 125486504) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is (Z,6S)-6-(1-cyanocyclopropyl)-6-hydroxy-3-(trifluoromethyl)hept-2-en-4-ynamide.
| Compound Name | (Z,6S)-6-(1-cyanocyclopropyl)-6-hydroxy-3-(trifluoromethyl)hept-2-en-4-ynamide |
|---|---|
| PubChem CID | 125486504 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (Z,6S)-6-(1-cyanocyclopropyl)-6-hydroxy-3-(trifluoromethyl)hept-2-en-4-ynamide |
| SMILES | C[C@](O)(C#C/C(=C/C(N)=O)C(F)(F)F)C1(C#N)CC1 |
| InChI | InChI=1S/C12H11F3N2O2/c1-10(19,11(7-16)4-5-11)3-2-8(6-9(17)18)12(13,14)15/h6,19H,4-5H2,1H3,(H2,17,18)/b8-6-/t10-/m0/s1 |
| InChIKey | HMGRIZAPTVRINV-ZEBCKKTISA-N |
| XLogP | 1.02 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|