C15H19NO3 — CID 125487160
(Z,6R)-6-(1-cyanocyclopropyl)-3-ethyl-6-hydroxy-7-methyloct-2-en-4-ynoic acid (PubChem CID 125487160) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (Z,6R)-6-(1-cyanocyclopropyl)-3-ethyl-6-hydroxy-7-methyloct-2-en-4-ynoic acid.
| Compound Name | (Z,6R)-6-(1-cyanocyclopropyl)-3-ethyl-6-hydroxy-7-methyloct-2-en-4-ynoic acid |
|---|---|
| PubChem CID | 125487160 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (Z,6R)-6-(1-cyanocyclopropyl)-3-ethyl-6-hydroxy-7-methyloct-2-en-4-ynoic acid |
| SMILES | CC/C(C#C[C@](O)(C(C)C)C1(C#N)CC1)=C/C(=O)O |
| InChI | InChI=1S/C15H19NO3/c1-4-12(9-13(17)18)5-6-15(19,11(2)3)14(10-16)7-8-14/h9,11,19H,4,7-8H2,1-3H3,(H,17,18)/b12-9-/t15-/m0/s1 |
| InChIKey | QYAIGKAYXDHQPQ-LMRWQKIVSA-N |
| XLogP | 2.10 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|