C10H13NO2 — CID 125490016
3-[(3S)-3-hydroxy-4-methylpent-1-yn-3-yl]oxetane-3-carbonitrile (PubChem CID 125490016) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-[(3S)-3-hydroxy-4-methylpent-1-yn-3-yl]oxetane-3-carbonitrile.
| Compound Name | 3-[(3S)-3-hydroxy-4-methylpent-1-yn-3-yl]oxetane-3-carbonitrile |
|---|---|
| PubChem CID | 125490016 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3-[(3S)-3-hydroxy-4-methylpent-1-yn-3-yl]oxetane-3-carbonitrile |
| SMILES | C#C[C@@](O)(C(C)C)C1(C#N)COC1 |
| InChI | InChI=1S/C10H13NO2/c1-4-10(12,8(2)3)9(5-11)6-13-7-9/h1,8,12H,6-7H2,2-3H3/t10-/m1/s1 |
| InChIKey | GHMDEKGTMXEBAP-SNVBAGLBSA-N |
| XLogP | 0.55 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|