C7H12F3NOSi — CID 125492394
(3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile (PubChem CID 125492394) has the molecular formula C7H12F3NOSi and a molecular weight of 211.26 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile.
| Compound Name | (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile |
|---|---|
| PubChem CID | 125492394 |
| Molecular Formula | C7H12F3NOSi |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile |
| SMILES | C[Si](C)(C)O[C@@H](CC#N)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NOSi/c1-13(2,3)12-6(4-5-11)7(8,9)10/h6H,4H2,1-3H3/t6-/m0/s1 |
| InChIKey | UKMXIRHPJUJMFQ-LURJTMIESA-N |
| XLogP | 2.68 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|