About (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile
(3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile (PubChem CID 125492394) has the molecular formula C7H12F3NOSi
and a molecular weight of 211.26 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile.
Molecular Properties
| Compound Name | (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile |
| PubChem CID | 125492394 |
| Molecular Formula | C7H12F3NOSi |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile |
| SMILES | C[Si](C)(C)O[C@@H](CC#N)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NOSi/c1-13(2,3)12-6(4-5-11)7(8,9)10/h6H,4H2,1-3H3/t6-/m0/s1 |
| InChIKey | UKMXIRHPJUJMFQ-LURJTMIESA-N |
| XLogP | 2.68 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile?
The IUPAC name of (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile (CID 125492394) is (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile.
What is the SMILES notation for (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile?
The canonical SMILES for (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile is C[Si](C)(C)O[C@@H](CC#N)C(F)(F)F.
What is the InChIKey of (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile?
The InChIKey is UKMXIRHPJUJMFQ-LURJTMIESA-N. The full InChI is InChI=1S/C7H12F3NOSi/c1-13(2,3)12-6(4-5-11)7(8,9)10/h6H,4H2,1-3H3/t6-/m0/s1.
What are the key properties of (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile?
(3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile has a molecular weight of 211.26 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4,4,4-trifluoro-3-trimethylsilyloxybutanenitrile is sourced from PubChem (CID 125492394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).