C15H14ClNOS — CID 125492420
(2S,3R)-3-(2-chlorothiophen-3-yl)-5-hydroxy-2-phenylpentanenitrile (PubChem CID 125492420) has the molecular formula C15H14ClNOS and a molecular weight of 291.80 g/mol. Its IUPAC name is (2S,3R)-3-(2-chlorothiophen-3-yl)-5-hydroxy-2-phenylpentanenitrile.
| Compound Name | (2S,3R)-3-(2-chlorothiophen-3-yl)-5-hydroxy-2-phenylpentanenitrile |
|---|---|
| PubChem CID | 125492420 |
| Molecular Formula | C15H14ClNOS |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | (2S,3R)-3-(2-chlorothiophen-3-yl)-5-hydroxy-2-phenylpentanenitrile |
| SMILES | N#C[C@H](c1ccccc1)[C@@H](CCO)c1ccsc1Cl |
| InChI | InChI=1S/C15H14ClNOS/c16-15-13(7-9-19-15)12(6-8-18)14(10-17)11-4-2-1-3-5-11/h1-5,7,9,12,14,18H,6,8H2/t12-,14+/m0/s1 |
| InChIKey | APYOVPXCPHZBFB-GXTWGEPZSA-N |
| XLogP | 4.17 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |