C16H15FN2O — CID 125488082
(2S,3S)-3-(6-fluoro-2-pyridinyl)-5-hydroxy-2-phenylpentanenitrile (PubChem CID 125488082) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is (2S,3S)-3-(6-fluoro-2-pyridinyl)-5-hydroxy-2-phenylpentanenitrile.
| Compound Name | (2S,3S)-3-(6-fluoro-2-pyridinyl)-5-hydroxy-2-phenylpentanenitrile |
|---|---|
| PubChem CID | 125488082 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2S,3S)-3-(6-fluoro-2-pyridinyl)-5-hydroxy-2-phenylpentanenitrile |
| SMILES | N#C[C@H](c1ccccc1)[C@H](CCO)c1cccc(F)n1 |
| InChI | InChI=1S/C16H15FN2O/c17-16-8-4-7-15(19-16)13(9-10-20)14(11-18)12-5-2-1-3-6-12/h1-8,13-14,20H,9-10H2/t13-,14+/m0/s1 |
| InChIKey | ASLNWABHXXZTLM-UONOGXRCSA-N |
| XLogP | 2.99 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|