C15H21NO — CID 125492837
(4aR,8aR)-8a-phenyl-1,2,3,4,5,6,7,8-octahydroquinolin-4a-ol (PubChem CID 125492837) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (4aR,8aR)-8a-phenyl-1,2,3,4,5,6,7,8-octahydroquinolin-4a-ol.
| Compound Name | (4aR,8aR)-8a-phenyl-1,2,3,4,5,6,7,8-octahydroquinolin-4a-ol |
|---|---|
| PubChem CID | 125492837 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (4aR,8aR)-8a-phenyl-1,2,3,4,5,6,7,8-octahydroquinolin-4a-ol |
| SMILES | O[C@@]12CCCC[C@]1(c1ccccc1)NCCC2 |
| InChI | InChI=1S/C15H21NO/c17-14-9-4-5-11-15(14,16-12-6-10-14)13-7-2-1-3-8-13/h1-3,7-8,16-17H,4-6,9-12H2/t14-,15-/m1/s1 |
| InChIKey | NNLVWJVXHNDVDW-HUUCEWRRSA-N |
| XLogP | 2.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |