C10H3F3O4S — CID 125493493
5-thiophen-2-yl-4-(2,2,2-trifluoroacetyl)furan-2,3-dione (PubChem CID 125493493) has the molecular formula C10H3F3O4S and a molecular weight of 276.19 g/mol. Its IUPAC name is 5-thiophen-2-yl-4-(2,2,2-trifluoroacetyl)furan-2,3-dione.
| Compound Name | 5-thiophen-2-yl-4-(2,2,2-trifluoroacetyl)furan-2,3-dione |
|---|---|
| PubChem CID | 125493493 |
| Molecular Formula | C10H3F3O4S |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 5-thiophen-2-yl-4-(2,2,2-trifluoroacetyl)furan-2,3-dione |
| SMILES | O=C1OC(c2cccs2)=C(C(=O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C10H3F3O4S/c11-10(12,13)8(15)5-6(14)9(16)17-7(5)4-2-1-3-18-4/h1-3H |
| InChIKey | CQEBTZONSKQQHV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|