C19H7F13O4S3 — CID 21093218
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]ethanone (PubChem CID 21093218) has the molecular formula C19H7F13O4S3 and a molecular weight of 642.44 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]ethanone.
| Compound Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 21093218 |
| Molecular Formula | C19H7F13O4S3 |
| Molecular Weight | 642.44 g/mol |
| Exact Mass | 641.93 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]ethanone |
| SMILES | O=C(c1ccc(-c2ccc(-c3cccs3)s2)s1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C19H7F13O4S3/c20-14(21,34-15(22,23)16(24,25)35-17(26,27)18(28,29)36-19(30,31)32)13(33)12-6-5-11(39-12)10-4-3-9(38-10)8-2-1-7-37-8/h1-7H |
| InChIKey | WLNGQMPFRMLNGC-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.44 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|