C18H21NO2S2 — CID 155429845
[(E)-[3-cyclopentyl-1-(5-thiophen-2-ylthiophen-2-yl)propylidene]amino] acetate (PubChem CID 155429845) has the molecular formula C18H21NO2S2 and a molecular weight of 347.50 g/mol. Its IUPAC name is [(E)-[3-cyclopentyl-1-(5-thiophen-2-ylthiophen-2-yl)propylidene]amino] acetate.
| Compound Name | [(E)-[3-cyclopentyl-1-(5-thiophen-2-ylthiophen-2-yl)propylidene]amino] acetate |
|---|---|
| PubChem CID | 155429845 |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [(E)-[3-cyclopentyl-1-(5-thiophen-2-ylthiophen-2-yl)propylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\CCC1CCCC1)c1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C18H21NO2S2/c1-13(20)21-19-15(9-8-14-5-2-3-6-14)16-10-11-18(23-16)17-7-4-12-22-17/h4,7,10-12,14H,2-3,5-6,8-9H2,1H3/b19-15+ |
| InChIKey | YYWNTTZDFLFNHF-XDJHFCHBSA-N |
| XLogP | 5.71 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|