C28H28O2S4Si — CID 101226249
[1,1-bis(5-thiophen-2-ylthiophen-2-yl)-4-triethylsilylbut-1-en-3-yn-2-yl] acetate (PubChem CID 101226249) has the molecular formula C28H28O2S4Si and a molecular weight of 552.88 g/mol. Its IUPAC name is [1,1-bis(5-thiophen-2-ylthiophen-2-yl)-4-triethylsilylbut-1-en-3-yn-2-yl] acetate.
| Compound Name | [1,1-bis(5-thiophen-2-ylthiophen-2-yl)-4-triethylsilylbut-1-en-3-yn-2-yl] acetate |
|---|---|
| PubChem CID | 101226249 |
| Molecular Formula | C28H28O2S4Si |
| Molecular Weight | 552.88 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | [1,1-bis(5-thiophen-2-ylthiophen-2-yl)-4-triethylsilylbut-1-en-3-yn-2-yl] acetate |
| SMILES | CC[Si](C#CC(OC(C)=O)=C(c1ccc(-c2cccs2)s1)c1ccc(-c2cccs2)s1)(CC)CC |
| InChI | InChI=1S/C28H28O2S4Si/c1-5-35(6-2,7-3)19-16-21(30-20(4)29)28(26-14-12-24(33-26)22-10-8-17-31-22)27-15-13-25(34-27)23-11-9-18-32-23/h8-15,17-18H,5-7H2,1-4H3 |
| InChIKey | GVCKFGTUZXNIAC-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.88 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|