C46H46S4Si2 — CID 102581509
2-[2,6-bis(5-thiophen-2-ylthiophen-2-yl)-10-(2-triethylsilylethynyl)anthracen-9-yl]ethynyl-triethylsilane (PubChem CID 102581509) has the molecular formula C46H46S4Si2 and a molecular weight of 783.31 g/mol. Its IUPAC name is 2-[2,6-bis(5-thiophen-2-ylthiophen-2-yl)-10-(2-triethylsilylethynyl)anthracen-9-yl]ethynyl-triethylsilane.
| Compound Name | 2-[2,6-bis(5-thiophen-2-ylthiophen-2-yl)-10-(2-triethylsilylethynyl)anthracen-9-yl]ethynyl-triethylsilane |
|---|---|
| PubChem CID | 102581509 |
| Molecular Formula | C46H46S4Si2 |
| Molecular Weight | 783.31 g/mol |
| Exact Mass | 782.20 |
| IUPAC Name | 2-[2,6-bis(5-thiophen-2-ylthiophen-2-yl)-10-(2-triethylsilylethynyl)anthracen-9-yl]ethynyl-triethylsilane |
| SMILES | CC[Si](C#Cc1c2ccc(-c3ccc(-c4cccs4)s3)cc2c(C#C[Si](CC)(CC)CC)c2ccc(-c3ccc(-c4cccs4)s3)cc12)(CC)CC |
| InChI | InChI=1S/C46H46S4Si2/c1-7-51(8-2,9-3)29-25-37-35-19-17-34(42-22-24-46(50-42)44-16-14-28-48-44)32-40(35)38(26-30-52(10-4,11-5)12-6)36-20-18-33(31-39(36)37)41-21-23-45(49-41)43-15-13-27-47-43/h13-24,27-28,31-32H,7-12H2,1-6H3 |
| InChIKey | SXLUMPKNDHYBDN-UHFFFAOYSA-N |
| XLogP | 15.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.31 |
| LogP ≤ 5 | 15.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|