C18H16OS3 — CID 101095189
4-phenylsulfanyl-1-(5-thiophen-2-ylthiophen-2-yl)butan-1-one (PubChem CID 101095189) has the molecular formula C18H16OS3 and a molecular weight of 344.53 g/mol. Its IUPAC name is 4-phenylsulfanyl-1-(5-thiophen-2-ylthiophen-2-yl)butan-1-one.
| Compound Name | 4-phenylsulfanyl-1-(5-thiophen-2-ylthiophen-2-yl)butan-1-one |
|---|---|
| PubChem CID | 101095189 |
| Molecular Formula | C18H16OS3 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 4-phenylsulfanyl-1-(5-thiophen-2-ylthiophen-2-yl)butan-1-one |
| SMILES | O=C(CCCSc1ccccc1)c1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C18H16OS3/c19-15(8-4-12-20-14-6-2-1-3-7-14)16-10-11-18(22-16)17-9-5-13-21-17/h1-3,5-7,9-11,13H,4,8,12H2 |
| InChIKey | OIUIOSXPPLGJRF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|