C16H5F15O3S2 — CID 21093220
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-1-(5-thiophen-2-ylthiophen-2-yl)ethanone (PubChem CID 21093220) has the molecular formula C16H5F15O3S2 and a molecular weight of 594.32 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-1-(5-thiophen-2-ylthiophen-2-yl)ethanone.
| Compound Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-1-(5-thiophen-2-ylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 21093220 |
| Molecular Formula | C16H5F15O3S2 |
| Molecular Weight | 594.32 g/mol |
| Exact Mass | 593.94 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-1-(5-thiophen-2-ylthiophen-2-yl)ethanone |
| SMILES | O=C(c1ccc(-c2cccs2)s1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H5F15O3S2/c17-10(18,9(32)8-4-3-7(36-8)6-2-1-5-35-6)33-15(28,29)16(30,31)34-14(26,27)12(21,22)11(19,20)13(23,24)25/h1-5H |
| InChIKey | ZDTURDOAJQXRSV-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.32 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|