C20H18O4S3 — CID 177442308
4-prop-2-enoyloxybutyl 5-(5-thiophen-2-ylthiophen-2-yl)thiophene-2-carboxylate (PubChem CID 177442308) has the molecular formula C20H18O4S3 and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-prop-2-enoyloxybutyl 5-(5-thiophen-2-ylthiophen-2-yl)thiophene-2-carboxylate.
| Compound Name | 4-prop-2-enoyloxybutyl 5-(5-thiophen-2-ylthiophen-2-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 177442308 |
| Molecular Formula | C20H18O4S3 |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 4-prop-2-enoyloxybutyl 5-(5-thiophen-2-ylthiophen-2-yl)thiophene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(-c2ccc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C20H18O4S3/c1-2-19(21)23-11-3-4-12-24-20(22)18-10-9-17(27-18)16-8-7-15(26-16)14-6-5-13-25-14/h2,5-10,13H,1,3-4,11-12H2 |
| InChIKey | ANWYHFZCRGSEMZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|