methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate

C12H14F2N2O3 — CID 125495032

IUPACmethyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate
SMILESC=Cc1ncnc(OCC(F)(F)CC)c1C(=O)OC
InChIInChI=1S/C12H14F2N2O3/c1-4-8-9(11(17)18-3)10(16-7-15-8)19-6-12(13,14)5-2/h4,7H,1,5-6H2,2-3H3
InChIKeyCPPAVTBWOFBMRR-UHFFFAOYSA-N
MW272.25 g/mol
LogP2.33
Rot. Bonds6

About methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate

methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate (PubChem CID 125495032) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate.

Molecular Properties

Compound Namemethyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate
PubChem CID125495032
Molecular FormulaC12H14F2N2O3
Molecular Weight272.25 g/mol
Exact Mass272.10
IUPAC Namemethyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate
SMILESC=Cc1ncnc(OCC(F)(F)CC)c1C(=O)OC
InChIInChI=1S/C12H14F2N2O3/c1-4-8-9(11(17)18-3)10(16-7-15-8)19-6-12(13,14)5-2/h4,7H,1,5-6H2,2-3H3
InChIKeyCPPAVTBWOFBMRR-UHFFFAOYSA-N
XLogP2.33
TPSA61.31 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.25
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate?
The IUPAC name of methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate (CID 125495032) is methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate.
What is the SMILES notation for methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate?
The canonical SMILES for methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate is C=Cc1ncnc(OCC(F)(F)CC)c1C(=O)OC.
What is the InChIKey of methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate?
The InChIKey is CPPAVTBWOFBMRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O3/c1-4-8-9(11(17)18-3)10(16-7-15-8)19-6-12(13,14)5-2/h4,7H,1,5-6H2,2-3H3.
What are the key properties of methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate?
methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate has a molecular weight of 272.25 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,2-difluorobutoxy)-6-ethenylpyrimidine-5-carboxylate is sourced from PubChem (CID 125495032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).