C12H15FN2O3 — CID 126686692
methyl 4-ethenyl-6-(2-fluoro-2-methylpropoxy)pyrimidine-5-carboxylate (PubChem CID 126686692) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is methyl 4-ethenyl-6-(2-fluoro-2-methylpropoxy)pyrimidine-5-carboxylate.
| Compound Name | methyl 4-ethenyl-6-(2-fluoro-2-methylpropoxy)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 126686692 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | methyl 4-ethenyl-6-(2-fluoro-2-methylpropoxy)pyrimidine-5-carboxylate |
| SMILES | C=Cc1ncnc(OCC(C)(C)F)c1C(=O)OC |
| InChI | InChI=1S/C12H15FN2O3/c1-5-8-9(11(16)17-4)10(15-7-14-8)18-6-12(2,3)13/h5,7H,1,6H2,2-4H3 |
| InChIKey | LQXSFYPCBNXKHO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |