About benzamido tert-butyl carbonate
benzamido tert-butyl carbonate (PubChem CID 125498000) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is benzamido tert-butyl carbonate.
Molecular Properties
| Compound Name | benzamido tert-butyl carbonate |
| PubChem CID | 125498000 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | benzamido tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO4/c1-12(2,3)16-11(15)17-13-10(14)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,13,14) |
| InChIKey | LOUJFSRCPLMUAI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamido tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido tert-butyl carbonate?
The IUPAC name of benzamido tert-butyl carbonate (CID 125498000) is benzamido tert-butyl carbonate.
What is the SMILES notation for benzamido tert-butyl carbonate?
The canonical SMILES for benzamido tert-butyl carbonate is CC(C)(C)OC(=O)ONC(=O)c1ccccc1.
What is the InChIKey of benzamido tert-butyl carbonate?
The InChIKey is LOUJFSRCPLMUAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-12(2,3)16-11(15)17-13-10(14)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,13,14).
What are the key properties of benzamido tert-butyl carbonate?
benzamido tert-butyl carbonate has a molecular weight of 237.25 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido tert-butyl carbonate is sourced from PubChem (CID 125498000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).