C19H23FN2O — CID 125498890
(2R)-N-(4-tert-butylphenyl)-2-(4-fluorophenyl)-2-(methylamino)acetamide (PubChem CID 125498890) has the molecular formula C19H23FN2O and a molecular weight of 314.40 g/mol. Its IUPAC name is (2R)-N-(4-tert-butylphenyl)-2-(4-fluorophenyl)-2-(methylamino)acetamide.
| Compound Name | (2R)-N-(4-tert-butylphenyl)-2-(4-fluorophenyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 125498890 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | (2R)-N-(4-tert-butylphenyl)-2-(4-fluorophenyl)-2-(methylamino)acetamide |
| SMILES | CN[C@@H](C(=O)Nc1ccc(C(C)(C)C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN2O/c1-19(2,3)14-7-11-16(12-8-14)22-18(23)17(21-4)13-5-9-15(20)10-6-13/h5-12,17,21H,1-4H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | JEKTUDCQQDDDAJ-QGZVFWFLSA-N |
| XLogP | 4.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |