C17H17N — CID 12552338
1-ethyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene (PubChem CID 12552338) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-ethyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene.
| Compound Name | 1-ethyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 12552338 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-ethyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene |
| SMILES | CCC12NC(Cc3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C17H17N/c1-2-17-14-9-5-3-7-12(14)11-16(18-17)13-8-4-6-10-15(13)17/h3-10,16,18H,2,11H2,1H3 |
| InChIKey | PWOMGUJYIACTOZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |