C21H21OPS — CID 12552741
2-[methyl(phenyl)phosphinothioyl]-1,1-diphenylethanol (PubChem CID 12552741) has the molecular formula C21H21OPS and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[methyl(phenyl)phosphinothioyl]-1,1-diphenylethanol.
| Compound Name | 2-[methyl(phenyl)phosphinothioyl]-1,1-diphenylethanol |
|---|---|
| PubChem CID | 12552741 |
| Molecular Formula | C21H21OPS |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[methyl(phenyl)phosphinothioyl]-1,1-diphenylethanol |
| SMILES | C[P@@](=S)(CC(O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21OPS/c1-23(24,20-15-9-4-10-16-20)17-21(22,18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-16,22H,17H2,1H3/t23-/m1/s1 |
| InChIKey | AEEJNAUPBCHPMZ-HSZRJFAPSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|