C14H22O — CID 12555701
(4aS,4bR,8aS,10aR)-2,3,4,4a,4b,5,6,7,8,8a,10,10a-dodecahydro-1H-phenanthren-9-one (PubChem CID 12555701) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (4aS,4bR,8aS,10aR)-2,3,4,4a,4b,5,6,7,8,8a,10,10a-dodecahydro-1H-phenanthren-9-one.
| Compound Name | (4aS,4bR,8aS,10aR)-2,3,4,4a,4b,5,6,7,8,8a,10,10a-dodecahydro-1H-phenanthren-9-one |
|---|---|
| PubChem CID | 12555701 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (4aS,4bR,8aS,10aR)-2,3,4,4a,4b,5,6,7,8,8a,10,10a-dodecahydro-1H-phenanthren-9-one |
| SMILES | O=C1C[C@H]2CCCC[C@@H]2[C@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C14H22O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h10-13H,1-9H2/t10-,11+,12-,13+/m1/s1 |
| InChIKey | YOZNXRXIVKCGKX-XQHKEYJVSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |