C11H18O — CID 162040407
methane;tricyclo[5.2.1.02,6]decan-8-one (PubChem CID 162040407) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is methane;tricyclo[5.2.1.02,6]decan-8-one.
| Compound Name | methane;tricyclo[5.2.1.02,6]decan-8-one |
|---|---|
| PubChem CID | 162040407 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | methane;tricyclo[5.2.1.02,6]decan-8-one |
| SMILES | C.O=C1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C10H14O.CH4/c11-10-5-6-4-9(10)8-3-1-2-7(6)8;/h6-9H,1-5H2;1H4 |
| InChIKey | YXEYWWSHVJCIER-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |