C20H28N2 — CID 125027928
(Z,1R,2R,6R,7S)-N-[(Z)-[(1R,2R,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]tricyclo[5.2.1.02,6]decan-8-imine (PubChem CID 125027928) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (Z,1R,2R,6R,7S)-N-[(Z)-[(1R,2R,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]tricyclo[5.2.1.02,6]decan-8-imine.
| Compound Name | (Z,1R,2R,6R,7S)-N-[(Z)-[(1R,2R,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]tricyclo[5.2.1.02,6]decan-8-imine |
|---|---|
| PubChem CID | 125027928 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (Z,1R,2R,6R,7S)-N-[(Z)-[(1R,2R,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]tricyclo[5.2.1.02,6]decan-8-imine |
| SMILES | C1C[C@@H]2[C@H]3C/C(=N/N=C4/C[C@H]5C[C@H]4[C@@H]4CCC[C@H]54)[C@@H](C3)[C@@H]2C1 |
| InChI | InChI=1S/C20H28N2/c1-3-13-11-7-17(15(13)5-1)19(9-11)21-22-20-10-12-8-18(20)16-6-2-4-14(12)16/h11-18H,1-10H2/b21-19-,22-20-/t11-,12-,13-,14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | IPMPDKGHTLRJQQ-SFUAFGPSSA-N |
| XLogP | 4.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|