C15H23N3O3S — CID 124884259
1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(E)-[(1R,2S,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]urea (PubChem CID 124884259) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(E)-[(1R,2S,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]urea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(E)-[(1R,2S,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]urea |
|---|---|
| PubChem CID | 124884259 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(E)-[(1R,2S,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]urea |
| SMILES | O=C(N/N=C1\C[C@H]2C[C@H]1[C@@H]1CCC[C@@H]21)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H23N3O3S/c19-15(16-10-4-5-22(20,21)8-10)18-17-14-7-9-6-13(14)12-3-1-2-11(9)12/h9-13H,1-8H2,(H2,16,18,19)/b17-14+/t9-,10+,11+,12-,13+/m1/s1 |
| InChIKey | IKNQMFZIFSCKKF-IVJAVIMVSA-N |
| XLogP | 1.28 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|