C15H24N2O — CID 129432055
(2S)-2-methyl-N-[[(1R,2S,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]butanamide (PubChem CID 129432055) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (2S)-2-methyl-N-[[(1R,2S,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]butanamide.
| Compound Name | (2S)-2-methyl-N-[[(1R,2S,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]butanamide |
|---|---|
| PubChem CID | 129432055 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (2S)-2-methyl-N-[[(1R,2S,6R,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino]butanamide |
| SMILES | CC[C@H](C)C(=O)NN=C1C[C@H]2C[C@H]1[C@@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C15H24N2O/c1-3-9(2)15(18)17-16-14-8-10-7-13(14)12-6-4-5-11(10)12/h9-13H,3-8H2,1-2H3,(H,17,18)/t9-,10+,11-,12+,13-/m0/s1 |
| InChIKey | SIXOJNKPMKSKOB-OFTGVCEQSA-N |
| XLogP | 2.96 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|